C20H24BrF3N4O — CID 138504412
3-[(6aR,9S,10aR)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1-ethyl-1-(2,2,2-trifluoroethyl)urea (PubChem CID 138504412) has the molecular formula C20H24BrF3N4O and a molecular weight of 473.34 g/mol. Its IUPAC name is 3-[(6aR,9S,10aR)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1-ethyl-1-(2,2,2-trifluoroethyl)urea.
| Compound Name | 3-[(6aR,9S,10aR)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1-ethyl-1-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 138504412 |
| Molecular Formula | C20H24BrF3N4O |
| Molecular Weight | 473.34 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 3-[(6aR,9S,10aR)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1-ethyl-1-(2,2,2-trifluoroethyl)urea |
| SMILES | CCN(CC(F)(F)F)C(=O)N[C@H]1C[C@@H]2c3cccc4[nH]c(Br)c(c34)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C20H24BrF3N4O/c1-3-28(10-20(22,23)24)19(29)25-11-7-13-12-5-4-6-15-17(12)14(18(21)26-15)8-16(13)27(2)9-11/h4-6,11,13,16,26H,3,7-10H2,1-2H3,(H,25,29)/t11-,13+,16+/m0/s1 |
| InChIKey | APCFGSCUCZWBJQ-NORZTCDRSA-N |
| XLogP | 4.24 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.34 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |