About cis-(1S,2S)-N-(6-bromo-1,3-benzothiazol-2-yl)-2-fluorocyclopropane-1-carboxamide
cis-(1S,2S)-N-(6-bromo-1,3-benzothiazol-2-yl)-2-fluorocyclopropane-1-carboxamide (PubChem CID 138504727) has the molecular formula C11H8BrFN2OS
and a molecular weight of 315.17 g/mol. Its IUPAC name is cis-(1S,2S)-N-(6-bromo-1,3-benzothiazol-2-yl)-2-fluorocyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | cis-(1S,2S)-N-(6-bromo-1,3-benzothiazol-2-yl)-2-fluorocyclopropane-1-carboxamide |
| PubChem CID | 138504727 |
| Molecular Formula | C11H8BrFN2OS |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 313.95 |
| IUPAC Name | cis-(1S,2S)-N-(6-bromo-1,3-benzothiazol-2-yl)-2-fluorocyclopropane-1-carboxamide |
| SMILES | O=C(Nc1nc2ccc(Br)cc2s1)[C@@H]1C[C@@H]1F |
| InChI | InChI=1S/C11H8BrFN2OS/c12-5-1-2-8-9(3-5)17-11(14-8)15-10(16)6-4-7(6)13/h1-3,6-7H,4H2,(H,14,15,16)/t6-,7+/m1/s1 |
| InChIKey | CXHQXAJESRGECC-RQJHMYQMSA-N |
| XLogP | 3.36 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cis-(1S,2S)-N-(6-bromo-1,3-benzothiazol-2-yl)-2-fluorocyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2S)-N-(6-bromo-1,3-benzothiazol-2-yl)-2-fluorocyclopropane-1-carboxamide?
The IUPAC name of cis-(1S,2S)-N-(6-bromo-1,3-benzothiazol-2-yl)-2-fluorocyclopropane-1-carboxamide (CID 138504727) is cis-(1S,2S)-N-(6-bromo-1,3-benzothiazol-2-yl)-2-fluorocyclopropane-1-carboxamide.
What is the SMILES notation for cis-(1S,2S)-N-(6-bromo-1,3-benzothiazol-2-yl)-2-fluorocyclopropane-1-carboxamide?
The canonical SMILES for cis-(1S,2S)-N-(6-bromo-1,3-benzothiazol-2-yl)-2-fluorocyclopropane-1-carboxamide is O=C(Nc1nc2ccc(Br)cc2s1)[C@@H]1C[C@@H]1F.
What is the InChIKey of cis-(1S,2S)-N-(6-bromo-1,3-benzothiazol-2-yl)-2-fluorocyclopropane-1-carboxamide?
The InChIKey is CXHQXAJESRGECC-RQJHMYQMSA-N. The full InChI is InChI=1S/C11H8BrFN2OS/c12-5-1-2-8-9(3-5)17-11(14-8)15-10(16)6-4-7(6)13/h1-3,6-7H,4H2,(H,14,15,16)/t6-,7+/m1/s1.
What are the key properties of cis-(1S,2S)-N-(6-bromo-1,3-benzothiazol-2-yl)-2-fluorocyclopropane-1-carboxamide?
cis-(1S,2S)-N-(6-bromo-1,3-benzothiazol-2-yl)-2-fluorocyclopropane-1-carboxamide has a molecular weight of 315.17 g/mol, XLogP of 3.36, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2S)-N-(6-bromo-1,3-benzothiazol-2-yl)-2-fluorocyclopropane-1-carboxamide is sourced from PubChem (CID 138504727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).