C16H16F3N3O5 — CID 138505141
N-[5-nitro-2-(trifluoromethoxy)phenyl]-1-(6-oxa-3-azabicyclo[3.1.1]heptan-3-yl)cyclopropane-1-carboxamide (PubChem CID 138505141) has the molecular formula C16H16F3N3O5 and a molecular weight of 387.31 g/mol. Its IUPAC name is N-[5-nitro-2-(trifluoromethoxy)phenyl]-1-(6-oxa-3-azabicyclo[3.1.1]heptan-3-yl)cyclopropane-1-carboxamide.
| Compound Name | N-[5-nitro-2-(trifluoromethoxy)phenyl]-1-(6-oxa-3-azabicyclo[3.1.1]heptan-3-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 138505141 |
| Molecular Formula | C16H16F3N3O5 |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | N-[5-nitro-2-(trifluoromethoxy)phenyl]-1-(6-oxa-3-azabicyclo[3.1.1]heptan-3-yl)cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1cc([N+](=O)[O-])ccc1OC(F)(F)F)C1(N2CC3CC(C2)O3)CC1 |
| InChI | InChI=1S/C16H16F3N3O5/c17-16(18,19)27-13-2-1-9(22(24)25)5-12(13)20-14(23)15(3-4-15)21-7-10-6-11(8-21)26-10/h1-2,5,10-11H,3-4,6-8H2,(H,20,23) |
| InChIKey | WDDMROPIZZHWFY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|