About 1,1'-biphenyl;(4-phenylsulfanylphenyl) 2,2,2-trifluoroacetate
1,1'-biphenyl;(4-phenylsulfanylphenyl) 2,2,2-trifluoroacetate (PubChem CID 138505603) has the molecular formula C26H19F3O2S
and a molecular weight of 452.50 g/mol. Its IUPAC name is 1,1'-biphenyl;(4-phenylsulfanylphenyl) 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | 1,1'-biphenyl;(4-phenylsulfanylphenyl) 2,2,2-trifluoroacetate |
| PubChem CID | 138505603 |
| Molecular Formula | C26H19F3O2S |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 1,1'-biphenyl;(4-phenylsulfanylphenyl) 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1ccc(Sc2ccccc2)cc1)C(F)(F)F.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C14H9F3O2S.C12H10/c15-14(16,17)13(18)19-10-6-8-12(9-7-10)20-11-4-2-1-3-5-11;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-9H;1-10H |
| InChIKey | LGJQVAVBFDMVLJ-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;(4-phenylsulfanylphenyl) 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;(4-phenylsulfanylphenyl) 2,2,2-trifluoroacetate?
The IUPAC name of 1,1'-biphenyl;(4-phenylsulfanylphenyl) 2,2,2-trifluoroacetate (CID 138505603) is 1,1'-biphenyl;(4-phenylsulfanylphenyl) 2,2,2-trifluoroacetate.
What is the SMILES notation for 1,1'-biphenyl;(4-phenylsulfanylphenyl) 2,2,2-trifluoroacetate?
The canonical SMILES for 1,1'-biphenyl;(4-phenylsulfanylphenyl) 2,2,2-trifluoroacetate is O=C(Oc1ccc(Sc2ccccc2)cc1)C(F)(F)F.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;(4-phenylsulfanylphenyl) 2,2,2-trifluoroacetate?
The InChIKey is LGJQVAVBFDMVLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F3O2S.C12H10/c15-14(16,17)13(18)19-10-6-8-12(9-7-10)20-11-4-2-1-3-5-11;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-9H;1-10H.
What are the key properties of 1,1'-biphenyl;(4-phenylsulfanylphenyl) 2,2,2-trifluoroacetate?
1,1'-biphenyl;(4-phenylsulfanylphenyl) 2,2,2-trifluoroacetate has a molecular weight of 452.50 g/mol, XLogP of 7.66, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;(4-phenylsulfanylphenyl) 2,2,2-trifluoroacetate is sourced from PubChem (CID 138505603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).