C25H27ClFN3O3 — CID 138505631
1-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole;(E)-oct-3-enoic acid (PubChem CID 138505631) has the molecular formula C25H27ClFN3O3 and a molecular weight of 471.96 g/mol. Its IUPAC name is 1-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole;(E)-oct-3-enoic acid.
| Compound Name | 1-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole;(E)-oct-3-enoic acid |
|---|---|
| PubChem CID | 138505631 |
| Molecular Formula | C25H27ClFN3O3 |
| Molecular Weight | 471.96 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 1-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole;(E)-oct-3-enoic acid |
| SMILES | CCCC/C=C/CC(=O)O.Fc1ccc(C2(Cn3cncn3)OC2c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C17H13ClFN3O.C8H14O2/c18-15-4-2-1-3-14(15)16-17(23-16,9-22-11-20-10-21-22)12-5-7-13(19)8-6-12;1-2-3-4-5-6-7-8(9)10/h1-8,10-11,16H,9H2;5-6H,2-4,7H2,1H3,(H,9,10)/b;6-5+ |
| InChIKey | DXGLBCYDTUVOJS-MXDQRGINSA-N |
| XLogP | 5.95 |
| TPSA | 80.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.96 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|