C18H19F3O10S — CID 138505934
(2S,4aR,6R,7S,8R,8aS)-7-acetyloxy-2-methyl-2-phenyl-8-(trifluoromethylsulfonyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylic acid (PubChem CID 138505934) has the molecular formula C18H19F3O10S and a molecular weight of 484.40 g/mol. Its IUPAC name is (2S,4aR,6R,7S,8R,8aS)-7-acetyloxy-2-methyl-2-phenyl-8-(trifluoromethylsulfonyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylic acid.
| Compound Name | (2S,4aR,6R,7S,8R,8aS)-7-acetyloxy-2-methyl-2-phenyl-8-(trifluoromethylsulfonyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylic acid |
|---|---|
| PubChem CID | 138505934 |
| Molecular Formula | C18H19F3O10S |
| Molecular Weight | 484.40 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | (2S,4aR,6R,7S,8R,8aS)-7-acetyloxy-2-methyl-2-phenyl-8-(trifluoromethylsulfonyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylic acid |
| SMILES | CC(=O)O[C@@H]1[C@H](OS(=O)(=O)C(F)(F)F)[C@H]2O[C@@](C)(c3ccccc3)OC[C@H]2O[C@H]1C(=O)O |
| InChI | InChI=1S/C18H19F3O10S/c1-9(22)28-13-14(31-32(25,26)18(19,20)21)12-11(29-15(13)16(23)24)8-27-17(2,30-12)10-6-4-3-5-7-10/h3-7,11-15H,8H2,1-2H3,(H,23,24)/t11-,12+,13-,14-,15-,17+/m1/s1 |
| InChIKey | HEIKMFVSBSUJHL-HJZPKHDNSA-N |
| XLogP | 1.29 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.40 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|