C48H34F12N8+4 — CID 138506174
2,3,5,7-tetrakis[1-(2,2,2-trifluoroethyl)pyridin-1-ium-2-yl]-21,23-dihydroporphyrin (PubChem CID 138506174) has the molecular formula C48H34F12N8+4 and a molecular weight of 950.83 g/mol. Its IUPAC name is 2,3,5,7-tetrakis[1-(2,2,2-trifluoroethyl)pyridin-1-ium-2-yl]-21,23-dihydroporphyrin.
| Compound Name | 2,3,5,7-tetrakis[1-(2,2,2-trifluoroethyl)pyridin-1-ium-2-yl]-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 138506174 |
| Molecular Formula | C48H34F12N8+4 |
| Molecular Weight | 950.83 g/mol |
| Exact Mass | 950.27 |
| IUPAC Name | 2,3,5,7-tetrakis[1-(2,2,2-trifluoroethyl)pyridin-1-ium-2-yl]-21,23-dihydroporphyrin |
| SMILES | FC(F)(F)C[n+]1ccccc1C1=Cc2cc3ccc(cc4nc(cc5[nH]c(c(-c6cccc[n+]6CC(F)(F)F)c1n2)c(-c1cccc[n+]1CC(F)(F)F)c5-c1cccc[n+]1CC(F)(F)F)C=C4)[nH]3 |
| InChI | InChI=1S/C48H32F12N8/c49-45(50,51)25-65-17-5-1-9-36(65)34-23-33-22-31-14-13-29(61-31)21-30-15-16-32(62-30)24-35-40(37-10-2-6-18-66(37)26-46(52,53)54)41(38-11-3-7-19-67(38)27-47(55,56)57)44(64-35)42(43(34)63-33)39-12-4-8-20-68(39)28-48(58,59)60/h1-24H,25-28H2/q+2/p+2/b29-21-,30-21-,31-22-,32-24-,33-22-,35-24-,43-42-,44-42- |
| InChIKey | WDWWSKOTZPJSBE-MPQHACKPSA-P |
| XLogP | 10.47 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 950.83 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|