C20H17F3N6O — CID 138506749
6-[(2E,4E)-4-amino-5-(methylideneamino)penta-2,4-dien-2-yl]-1-[6-(trifluoromethyl)-2-pyridinyl]indazole-4-carboxamide (PubChem CID 138506749) has the molecular formula C20H17F3N6O and a molecular weight of 414.39 g/mol. Its IUPAC name is 6-[(2E,4E)-4-amino-5-(methylideneamino)penta-2,4-dien-2-yl]-1-[6-(trifluoromethyl)-2-pyridinyl]indazole-4-carboxamide.
| Compound Name | 6-[(2E,4E)-4-amino-5-(methylideneamino)penta-2,4-dien-2-yl]-1-[6-(trifluoromethyl)-2-pyridinyl]indazole-4-carboxamide |
|---|---|
| PubChem CID | 138506749 |
| Molecular Formula | C20H17F3N6O |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 6-[(2E,4E)-4-amino-5-(methylideneamino)penta-2,4-dien-2-yl]-1-[6-(trifluoromethyl)-2-pyridinyl]indazole-4-carboxamide |
| SMILES | C=N/C=C(N)\C=C(/C)c1cc(C(N)=O)c2cnn(-c3cccc(C(F)(F)F)n3)c2c1 |
| InChI | InChI=1S/C20H17F3N6O/c1-11(6-13(24)9-26-2)12-7-14(19(25)30)15-10-27-29(16(15)8-12)18-5-3-4-17(28-18)20(21,22)23/h3-10H,2,24H2,1H3,(H2,25,30)/b11-6+,13-9+ |
| InChIKey | CRUMBKIJBXGZLJ-SVWNPJEBSA-N |
| XLogP | 3.44 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|