C54H32Cl2N4 — CID 138506877
4-[2-chloro-5-(1,10-phenanthrolin-3-yl)phenyl]-10-(2-chlorophenyl)-6,12-diphenyl-5,11-dihydroindolo[3,2-b]carbazole (PubChem CID 138506877) has the molecular formula C54H32Cl2N4 and a molecular weight of 807.78 g/mol. Its IUPAC name is 4-[2-chloro-5-(1,10-phenanthrolin-3-yl)phenyl]-10-(2-chlorophenyl)-6,12-diphenyl-5,11-dihydroindolo[3,2-b]carbazole.
| Compound Name | 4-[2-chloro-5-(1,10-phenanthrolin-3-yl)phenyl]-10-(2-chlorophenyl)-6,12-diphenyl-5,11-dihydroindolo[3,2-b]carbazole |
|---|---|
| PubChem CID | 138506877 |
| Molecular Formula | C54H32Cl2N4 |
| Molecular Weight | 807.78 g/mol |
| Exact Mass | 806.20 |
| IUPAC Name | 4-[2-chloro-5-(1,10-phenanthrolin-3-yl)phenyl]-10-(2-chlorophenyl)-6,12-diphenyl-5,11-dihydroindolo[3,2-b]carbazole |
| SMILES | Clc1ccccc1-c1cccc2c1[nH]c1c(-c3ccccc3)c3c([nH]c4c(-c5cc(-c6cnc7c(ccc8cccnc87)c6)ccc5Cl)cccc43)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C54H32Cl2N4/c55-43-22-8-7-17-37(43)38-18-9-20-40-47-45(31-12-3-1-4-13-31)54-48(46(53(47)59-51(38)40)32-14-5-2-6-15-32)41-21-10-19-39(52(41)60-54)42-29-34(25-26-44(42)56)36-28-35-24-23-33-16-11-27-57-49(33)50(35)58-30-36/h1-30,59-60H |
| InChIKey | UUHQUURSXQDOSR-UHFFFAOYSA-N |
| XLogP | 15.69 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.78 |
| LogP ≤ 5 | 15.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|