C10H20N2 — CID 138507133
2-[(2R,3R)-3-ethenyl-2-methylpiperidin-1-yl]ethanamine (PubChem CID 138507133) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 2-[(2R,3R)-3-ethenyl-2-methylpiperidin-1-yl]ethanamine.
| Compound Name | 2-[(2R,3R)-3-ethenyl-2-methylpiperidin-1-yl]ethanamine |
|---|---|
| PubChem CID | 138507133 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 2-[(2R,3R)-3-ethenyl-2-methylpiperidin-1-yl]ethanamine |
| SMILES | C=C[C@H]1CCCN(CCN)[C@@H]1C |
| InChI | InChI=1S/C10H20N2/c1-3-10-5-4-7-12(8-6-11)9(10)2/h3,9-10H,1,4-8,11H2,2H3/t9-,10+/m1/s1 |
| InChIKey | VUPJXRAUQLIODY-ZJUUUORDSA-N |
| XLogP | 1.23 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|