C15H23N3 — CID 138507145
[(4E)-8-imino-2,2,7,7-tetramethyldeca-4,9-dien-3-ylidene]cyanamide (PubChem CID 138507145) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is [(4E)-8-imino-2,2,7,7-tetramethyldeca-4,9-dien-3-ylidene]cyanamide.
| Compound Name | [(4E)-8-imino-2,2,7,7-tetramethyldeca-4,9-dien-3-ylidene]cyanamide |
|---|---|
| PubChem CID | 138507145 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | [(4E)-8-imino-2,2,7,7-tetramethyldeca-4,9-dien-3-ylidene]cyanamide |
| SMILES | [H]/N=C(\C=C)C(C)(C)C/C=C/C(=N/C#N)C(C)(C)C |
| InChI | InChI=1S/C15H23N3/c1-7-12(17)15(5,6)10-8-9-13(18-11-16)14(2,3)4/h7-9,17H,1,10H2,2-6H3/b9-8+,17-12+,18-13- |
| InChIKey | AGBRNIXKEHRJQM-MXHPTIGVSA-N |
| XLogP | 4.13 |
| TPSA | 60.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|