About (Z,3E)-N-(2,4-dimethylpentyl)-3-ethylidene-6-methylhept-4-en-2-amine
(Z,3E)-N-(2,4-dimethylpentyl)-3-ethylidene-6-methylhept-4-en-2-amine (PubChem CID 138507756) has the molecular formula C17H33N
and a molecular weight of 251.46 g/mol. Its IUPAC name is (Z,3E)-N-(2,4-dimethylpentyl)-3-ethylidene-6-methylhept-4-en-2-amine.
Molecular Properties
| Compound Name | (Z,3E)-N-(2,4-dimethylpentyl)-3-ethylidene-6-methylhept-4-en-2-amine |
| PubChem CID | 138507756 |
| Molecular Formula | C17H33N |
| Molecular Weight | 251.46 g/mol |
| Exact Mass | 251.26 |
| IUPAC Name | (Z,3E)-N-(2,4-dimethylpentyl)-3-ethylidene-6-methylhept-4-en-2-amine |
| SMILES | C/C=C(\C=C/C(C)C)C(C)NCC(C)CC(C)C |
| InChI | InChI=1S/C17H33N/c1-8-17(10-9-13(2)3)16(7)18-12-15(6)11-14(4)5/h8-10,13-16,18H,11-12H2,1-7H3/b10-9-,17-8+ |
| InChIKey | LVYRLNUTIWIHRT-QBYMHUFYSA-N |
| XLogP | 4.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z,3E)-N-(2,4-dimethylpentyl)-3-ethylidene-6-methylhept-4-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,3E)-N-(2,4-dimethylpentyl)-3-ethylidene-6-methylhept-4-en-2-amine?
The IUPAC name of (Z,3E)-N-(2,4-dimethylpentyl)-3-ethylidene-6-methylhept-4-en-2-amine (CID 138507756) is (Z,3E)-N-(2,4-dimethylpentyl)-3-ethylidene-6-methylhept-4-en-2-amine.
What is the SMILES notation for (Z,3E)-N-(2,4-dimethylpentyl)-3-ethylidene-6-methylhept-4-en-2-amine?
The canonical SMILES for (Z,3E)-N-(2,4-dimethylpentyl)-3-ethylidene-6-methylhept-4-en-2-amine is C/C=C(\C=C/C(C)C)C(C)NCC(C)CC(C)C.
What is the InChIKey of (Z,3E)-N-(2,4-dimethylpentyl)-3-ethylidene-6-methylhept-4-en-2-amine?
The InChIKey is LVYRLNUTIWIHRT-QBYMHUFYSA-N. The full InChI is InChI=1S/C17H33N/c1-8-17(10-9-13(2)3)16(7)18-12-15(6)11-14(4)5/h8-10,13-16,18H,11-12H2,1-7H3/b10-9-,17-8+.
What are the key properties of (Z,3E)-N-(2,4-dimethylpentyl)-3-ethylidene-6-methylhept-4-en-2-amine?
(Z,3E)-N-(2,4-dimethylpentyl)-3-ethylidene-6-methylhept-4-en-2-amine has a molecular weight of 251.46 g/mol, XLogP of 4.81, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,3E)-N-(2,4-dimethylpentyl)-3-ethylidene-6-methylhept-4-en-2-amine is sourced from PubChem (CID 138507756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).