About 1-buta-2,3-dienyl-3-ethyl-4-methylpyrrolidine
1-buta-2,3-dienyl-3-ethyl-4-methylpyrrolidine (PubChem CID 138507775) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is 1-buta-2,3-dienyl-3-ethyl-4-methylpyrrolidine.
Molecular Properties
| Compound Name | 1-buta-2,3-dienyl-3-ethyl-4-methylpyrrolidine |
| PubChem CID | 138507775 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 1-buta-2,3-dienyl-3-ethyl-4-methylpyrrolidine |
| SMILES | C=C=CCN1CC(C)C(CC)C1 |
| InChI | InChI=1S/C11H19N/c1-4-6-7-12-8-10(3)11(5-2)9-12/h6,10-11H,1,5,7-9H2,2-3H3 |
| InChIKey | FZTMAKCJZFDCIY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-buta-2,3-dienyl-3-ethyl-4-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-buta-2,3-dienyl-3-ethyl-4-methylpyrrolidine?
The IUPAC name of 1-buta-2,3-dienyl-3-ethyl-4-methylpyrrolidine (CID 138507775) is 1-buta-2,3-dienyl-3-ethyl-4-methylpyrrolidine.
What is the SMILES notation for 1-buta-2,3-dienyl-3-ethyl-4-methylpyrrolidine?
The canonical SMILES for 1-buta-2,3-dienyl-3-ethyl-4-methylpyrrolidine is C=C=CCN1CC(C)C(CC)C1.
What is the InChIKey of 1-buta-2,3-dienyl-3-ethyl-4-methylpyrrolidine?
The InChIKey is FZTMAKCJZFDCIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N/c1-4-6-7-12-8-10(3)11(5-2)9-12/h6,10-11H,1,5,7-9H2,2-3H3.
What are the key properties of 1-buta-2,3-dienyl-3-ethyl-4-methylpyrrolidine?
1-buta-2,3-dienyl-3-ethyl-4-methylpyrrolidine has a molecular weight of 165.28 g/mol, XLogP of 2.31, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-buta-2,3-dienyl-3-ethyl-4-methylpyrrolidine is sourced from PubChem (CID 138507775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).