About N-(2-methylcyclohexa-2,4-dien-1-yl)ethanimine
N-(2-methylcyclohexa-2,4-dien-1-yl)ethanimine (PubChem CID 138507988) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is N-(2-methylcyclohexa-2,4-dien-1-yl)ethanimine.
Molecular Properties
| Compound Name | N-(2-methylcyclohexa-2,4-dien-1-yl)ethanimine |
| PubChem CID | 138507988 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | N-(2-methylcyclohexa-2,4-dien-1-yl)ethanimine |
| SMILES | C/C=N/C1CC=CC=C1C |
| InChI | InChI=1S/C9H13N/c1-3-10-9-7-5-4-6-8(9)2/h3-6,9H,7H2,1-2H3/b10-3+ |
| InChIKey | KXBJGWNVLNMGLL-XCVCLJGOSA-N |
| XLogP | 2.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methylcyclohexa-2,4-dien-1-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methylcyclohexa-2,4-dien-1-yl)ethanimine?
The IUPAC name of N-(2-methylcyclohexa-2,4-dien-1-yl)ethanimine (CID 138507988) is N-(2-methylcyclohexa-2,4-dien-1-yl)ethanimine.
What is the SMILES notation for N-(2-methylcyclohexa-2,4-dien-1-yl)ethanimine?
The canonical SMILES for N-(2-methylcyclohexa-2,4-dien-1-yl)ethanimine is C/C=N/C1CC=CC=C1C.
What is the InChIKey of N-(2-methylcyclohexa-2,4-dien-1-yl)ethanimine?
The InChIKey is KXBJGWNVLNMGLL-XCVCLJGOSA-N. The full InChI is InChI=1S/C9H13N/c1-3-10-9-7-5-4-6-8(9)2/h3-6,9H,7H2,1-2H3/b10-3+.
What are the key properties of N-(2-methylcyclohexa-2,4-dien-1-yl)ethanimine?
N-(2-methylcyclohexa-2,4-dien-1-yl)ethanimine has a molecular weight of 135.21 g/mol, XLogP of 2.35, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylcyclohexa-2,4-dien-1-yl)ethanimine is sourced from PubChem (CID 138507988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).