About [3-(2,6-dichlorophenyl)-5-(2-fluoropropan-2-yl)-1,2-oxazol-4-yl]methanol
[3-(2,6-dichlorophenyl)-5-(2-fluoropropan-2-yl)-1,2-oxazol-4-yl]methanol (PubChem CID 138508058) has the molecular formula C13H12Cl2FNO2
and a molecular weight of 304.15 g/mol. Its IUPAC name is [3-(2,6-dichlorophenyl)-5-(2-fluoropropan-2-yl)-1,2-oxazol-4-yl]methanol.
Molecular Properties
| Compound Name | [3-(2,6-dichlorophenyl)-5-(2-fluoropropan-2-yl)-1,2-oxazol-4-yl]methanol |
| PubChem CID | 138508058 |
| Molecular Formula | C13H12Cl2FNO2 |
| Molecular Weight | 304.15 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | [3-(2,6-dichlorophenyl)-5-(2-fluoropropan-2-yl)-1,2-oxazol-4-yl]methanol |
| SMILES | CC(C)(F)c1onc(-c2c(Cl)cccc2Cl)c1CO |
| InChI | InChI=1S/C13H12Cl2FNO2/c1-13(2,16)12-7(6-18)11(17-19-12)10-8(14)4-3-5-9(10)15/h3-5,18H,6H2,1-2H3 |
| InChIKey | PCJHKZVPHMRDEX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.15 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(2,6-dichlorophenyl)-5-(2-fluoropropan-2-yl)-1,2-oxazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2,6-dichlorophenyl)-5-(2-fluoropropan-2-yl)-1,2-oxazol-4-yl]methanol?
The IUPAC name of [3-(2,6-dichlorophenyl)-5-(2-fluoropropan-2-yl)-1,2-oxazol-4-yl]methanol (CID 138508058) is [3-(2,6-dichlorophenyl)-5-(2-fluoropropan-2-yl)-1,2-oxazol-4-yl]methanol.
What is the SMILES notation for [3-(2,6-dichlorophenyl)-5-(2-fluoropropan-2-yl)-1,2-oxazol-4-yl]methanol?
The canonical SMILES for [3-(2,6-dichlorophenyl)-5-(2-fluoropropan-2-yl)-1,2-oxazol-4-yl]methanol is CC(C)(F)c1onc(-c2c(Cl)cccc2Cl)c1CO.
What is the InChIKey of [3-(2,6-dichlorophenyl)-5-(2-fluoropropan-2-yl)-1,2-oxazol-4-yl]methanol?
The InChIKey is PCJHKZVPHMRDEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12Cl2FNO2/c1-13(2,16)12-7(6-18)11(17-19-12)10-8(14)4-3-5-9(10)15/h3-5,18H,6H2,1-2H3.
What are the key properties of [3-(2,6-dichlorophenyl)-5-(2-fluoropropan-2-yl)-1,2-oxazol-4-yl]methanol?
[3-(2,6-dichlorophenyl)-5-(2-fluoropropan-2-yl)-1,2-oxazol-4-yl]methanol has a molecular weight of 304.15 g/mol, XLogP of 4.35, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2,6-dichlorophenyl)-5-(2-fluoropropan-2-yl)-1,2-oxazol-4-yl]methanol is sourced from PubChem (CID 138508058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).