About (E)-N'-(ethylaminomethyl)-N',3-dimethyl-2-(trifluoromethyl)pent-1-ene-1,5-diamine
(E)-N'-(ethylaminomethyl)-N',3-dimethyl-2-(trifluoromethyl)pent-1-ene-1,5-diamine (PubChem CID 138508157) has the molecular formula C11H22F3N3
and a molecular weight of 253.31 g/mol. Its IUPAC name is (E)-N'-(ethylaminomethyl)-N',3-dimethyl-2-(trifluoromethyl)pent-1-ene-1,5-diamine.
Molecular Properties
| Compound Name | (E)-N'-(ethylaminomethyl)-N',3-dimethyl-2-(trifluoromethyl)pent-1-ene-1,5-diamine |
| PubChem CID | 138508157 |
| Molecular Formula | C11H22F3N3 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | (E)-N'-(ethylaminomethyl)-N',3-dimethyl-2-(trifluoromethyl)pent-1-ene-1,5-diamine |
| SMILES | CCNCN(C)CCC(C)/C(=C\N)C(F)(F)F |
| InChI | InChI=1S/C11H22F3N3/c1-4-16-8-17(3)6-5-9(2)10(7-15)11(12,13)14/h7,9,16H,4-6,8,15H2,1-3H3/b10-7+ |
| InChIKey | KFKUCBQZTFYPCW-JXMROGBWSA-N |
| XLogP | 1.92 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (E)-N'-(ethylaminomethyl)-N',3-dimethyl-2-(trifluoromethyl)pent-1-ene-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N'-(ethylaminomethyl)-N',3-dimethyl-2-(trifluoromethyl)pent-1-ene-1,5-diamine?
The IUPAC name of (E)-N'-(ethylaminomethyl)-N',3-dimethyl-2-(trifluoromethyl)pent-1-ene-1,5-diamine (CID 138508157) is (E)-N'-(ethylaminomethyl)-N',3-dimethyl-2-(trifluoromethyl)pent-1-ene-1,5-diamine.
What is the SMILES notation for (E)-N'-(ethylaminomethyl)-N',3-dimethyl-2-(trifluoromethyl)pent-1-ene-1,5-diamine?
The canonical SMILES for (E)-N'-(ethylaminomethyl)-N',3-dimethyl-2-(trifluoromethyl)pent-1-ene-1,5-diamine is CCNCN(C)CCC(C)/C(=C\N)C(F)(F)F.
What is the InChIKey of (E)-N'-(ethylaminomethyl)-N',3-dimethyl-2-(trifluoromethyl)pent-1-ene-1,5-diamine?
The InChIKey is KFKUCBQZTFYPCW-JXMROGBWSA-N. The full InChI is InChI=1S/C11H22F3N3/c1-4-16-8-17(3)6-5-9(2)10(7-15)11(12,13)14/h7,9,16H,4-6,8,15H2,1-3H3/b10-7+.
What are the key properties of (E)-N'-(ethylaminomethyl)-N',3-dimethyl-2-(trifluoromethyl)pent-1-ene-1,5-diamine?
(E)-N'-(ethylaminomethyl)-N',3-dimethyl-2-(trifluoromethyl)pent-1-ene-1,5-diamine has a molecular weight of 253.31 g/mol, XLogP of 1.92, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N'-(ethylaminomethyl)-N',3-dimethyl-2-(trifluoromethyl)pent-1-ene-1,5-diamine is sourced from PubChem (CID 138508157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).