About 3-(3-iodophenyl)-2,2-dimethylpropanoic acid
3-(3-iodophenyl)-2,2-dimethylpropanoic acid (PubChem CID 138508187) has the molecular formula C11H13IO2
and a molecular weight of 304.13 g/mol. Its IUPAC name is 3-(3-iodophenyl)-2,2-dimethylpropanoic acid.
Molecular Properties
| Compound Name | 3-(3-iodophenyl)-2,2-dimethylpropanoic acid |
| PubChem CID | 138508187 |
| Molecular Formula | C11H13IO2 |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | 3-(3-iodophenyl)-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(Cc1cccc(I)c1)C(=O)O |
| InChI | InChI=1S/C11H13IO2/c1-11(2,10(13)14)7-8-4-3-5-9(12)6-8/h3-6H,7H2,1-2H3,(H,13,14) |
| InChIKey | ARBIYNYIKKGPOT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-iodophenyl)-2,2-dimethylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-iodophenyl)-2,2-dimethylpropanoic acid?
The IUPAC name of 3-(3-iodophenyl)-2,2-dimethylpropanoic acid (CID 138508187) is 3-(3-iodophenyl)-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-(3-iodophenyl)-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-(3-iodophenyl)-2,2-dimethylpropanoic acid is CC(C)(Cc1cccc(I)c1)C(=O)O.
What is the InChIKey of 3-(3-iodophenyl)-2,2-dimethylpropanoic acid?
The InChIKey is ARBIYNYIKKGPOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13IO2/c1-11(2,10(13)14)7-8-4-3-5-9(12)6-8/h3-6H,7H2,1-2H3,(H,13,14).
What are the key properties of 3-(3-iodophenyl)-2,2-dimethylpropanoic acid?
3-(3-iodophenyl)-2,2-dimethylpropanoic acid has a molecular weight of 304.13 g/mol, XLogP of 2.94, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-iodophenyl)-2,2-dimethylpropanoic acid is sourced from PubChem (CID 138508187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).