C8H11NO — CID 138508447
(3E,5Z)-2-methanimidoylhepta-1,3,5-trien-3-ol (PubChem CID 138508447) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is (3E,5Z)-2-methanimidoylhepta-1,3,5-trien-3-ol.
| Compound Name | (3E,5Z)-2-methanimidoylhepta-1,3,5-trien-3-ol |
|---|---|
| PubChem CID | 138508447 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | (3E,5Z)-2-methanimidoylhepta-1,3,5-trien-3-ol |
| SMILES | [H]/N=C/C(=C)/C(O)=C\C=C/C |
| InChI | InChI=1S/C8H11NO/c1-3-4-5-8(10)7(2)6-9/h3-6,9-10H,2H2,1H3/b4-3-,8-5+,9-6+ |
| InChIKey | NZRIPQALUYSWCT-WYELLYRHSA-N |
| XLogP | 2.21 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|