About (E,7S)-N,7-dimethylnon-4-en-1-imine
(E,7S)-N,7-dimethylnon-4-en-1-imine (PubChem CID 138508508) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is (E,7S)-N,7-dimethylnon-4-en-1-imine.
Molecular Properties
| Compound Name | (E,7S)-N,7-dimethylnon-4-en-1-imine |
| PubChem CID | 138508508 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (E,7S)-N,7-dimethylnon-4-en-1-imine |
| SMILES | CC[C@H](C)C/C=C/CC/C=N/C |
| InChI | InChI=1S/C11H21N/c1-4-11(2)9-7-5-6-8-10-12-3/h5,7,10-11H,4,6,8-9H2,1-3H3/b7-5+,12-10+/t11-/m0/s1 |
| InChIKey | OHZZRFWUTAZRKA-RBIQHZELSA-N |
| XLogP | 3.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E,7S)-N,7-dimethylnon-4-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,7S)-N,7-dimethylnon-4-en-1-imine?
The IUPAC name of (E,7S)-N,7-dimethylnon-4-en-1-imine (CID 138508508) is (E,7S)-N,7-dimethylnon-4-en-1-imine.
What is the SMILES notation for (E,7S)-N,7-dimethylnon-4-en-1-imine?
The canonical SMILES for (E,7S)-N,7-dimethylnon-4-en-1-imine is CC[C@H](C)C/C=C/CC/C=N/C.
What is the InChIKey of (E,7S)-N,7-dimethylnon-4-en-1-imine?
The InChIKey is OHZZRFWUTAZRKA-RBIQHZELSA-N. The full InChI is InChI=1S/C11H21N/c1-4-11(2)9-7-5-6-8-10-12-3/h5,7,10-11H,4,6,8-9H2,1-3H3/b7-5+,12-10+/t11-/m0/s1.
What are the key properties of (E,7S)-N,7-dimethylnon-4-en-1-imine?
(E,7S)-N,7-dimethylnon-4-en-1-imine has a molecular weight of 167.30 g/mol, XLogP of 3.46, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E,7S)-N,7-dimethylnon-4-en-1-imine is sourced from PubChem (CID 138508508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).