C24H23ClN4O4 — CID 138508821
4-[4-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]oxane-4-carbonitrile (PubChem CID 138508821) has the molecular formula C24H23ClN4O4 and a molecular weight of 466.93 g/mol. Its IUPAC name is 4-[4-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]oxane-4-carbonitrile.
| Compound Name | 4-[4-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]oxane-4-carbonitrile |
|---|---|
| PubChem CID | 138508821 |
| Molecular Formula | C24H23ClN4O4 |
| Molecular Weight | 466.93 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 4-[4-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]oxane-4-carbonitrile |
| SMILES | N#CC1(c2ccc(-c3nc4nc(OC5CO[C@@H]6CCO[C@H]56)[nH]c4cc3Cl)cc2)CCOCC1 |
| InChI | InChI=1S/C24H23ClN4O4/c25-16-11-17-22(29-23(27-17)33-19-12-32-18-5-8-31-21(18)19)28-20(16)14-1-3-15(4-2-14)24(13-26)6-9-30-10-7-24/h1-4,11,18-19,21H,5-10,12H2,(H,27,28,29)/t18-,19?,21+/m1/s1 |
| InChIKey | CIDQVQBTFPFPGR-DRPMKMPGSA-N |
| XLogP | 3.79 |
| TPSA | 102.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.93 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |