C26H22ClN3O4 — CID 138508925
(3R,6R)-3-[[6-chloro-5-(4-phenylphenyl)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-6-ethenyl-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-ol (PubChem CID 138508925) has the molecular formula C26H22ClN3O4 and a molecular weight of 475.93 g/mol. Its IUPAC name is (3R,6R)-3-[[6-chloro-5-(4-phenylphenyl)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-6-ethenyl-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-ol.
| Compound Name | (3R,6R)-3-[[6-chloro-5-(4-phenylphenyl)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-6-ethenyl-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-ol |
|---|---|
| PubChem CID | 138508925 |
| Molecular Formula | C26H22ClN3O4 |
| Molecular Weight | 475.93 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | (3R,6R)-3-[[6-chloro-5-(4-phenylphenyl)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-6-ethenyl-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-ol |
| SMILES | C=C[C@@]1(O)COC2C1OC[C@H]2Oc1nc2nc(-c3ccc(-c4ccccc4)cc3)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C26H22ClN3O4/c1-2-26(31)14-33-22-20(13-32-23(22)26)34-25-28-19-12-18(27)21(29-24(19)30-25)17-10-8-16(9-11-17)15-6-4-3-5-7-15/h2-12,20,22-23,31H,1,13-14H2,(H,28,29,30)/t20-,22?,23?,26-/m1/s1 |
| InChIKey | CFFMFMBMVDSQLV-KFCKGTRVSA-N |
| XLogP | 4.41 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.93 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|