About 1-[4-[4-(5,6-diamino-3-chloro-2-pyridinyl)phenyl]phenyl]-2-methylpropan-2-ol
1-[4-[4-(5,6-diamino-3-chloro-2-pyridinyl)phenyl]phenyl]-2-methylpropan-2-ol (PubChem CID 138509029) has the molecular formula C21H22ClN3O
and a molecular weight of 367.88 g/mol. Its IUPAC name is 1-[4-[4-(5,6-diamino-3-chloro-2-pyridinyl)phenyl]phenyl]-2-methylpropan-2-ol.
Molecular Properties
| Compound Name | 1-[4-[4-(5,6-diamino-3-chloro-2-pyridinyl)phenyl]phenyl]-2-methylpropan-2-ol |
| PubChem CID | 138509029 |
| Molecular Formula | C21H22ClN3O |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 1-[4-[4-(5,6-diamino-3-chloro-2-pyridinyl)phenyl]phenyl]-2-methylpropan-2-ol |
| SMILES | CC(C)(O)Cc1ccc(-c2ccc(-c3nc(N)c(N)cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C21H22ClN3O/c1-21(2,26)12-13-3-5-14(6-4-13)15-7-9-16(10-8-15)19-17(22)11-18(23)20(24)25-19/h3-11,26H,12,23H2,1-2H3,(H2,24,25) |
| InChIKey | CUUZGLRZIOVDQA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-[4-(5,6-diamino-3-chloro-2-pyridinyl)phenyl]phenyl]-2-methylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[4-(5,6-diamino-3-chloro-2-pyridinyl)phenyl]phenyl]-2-methylpropan-2-ol?
The IUPAC name of 1-[4-[4-(5,6-diamino-3-chloro-2-pyridinyl)phenyl]phenyl]-2-methylpropan-2-ol (CID 138509029) is 1-[4-[4-(5,6-diamino-3-chloro-2-pyridinyl)phenyl]phenyl]-2-methylpropan-2-ol.
What is the SMILES notation for 1-[4-[4-(5,6-diamino-3-chloro-2-pyridinyl)phenyl]phenyl]-2-methylpropan-2-ol?
The canonical SMILES for 1-[4-[4-(5,6-diamino-3-chloro-2-pyridinyl)phenyl]phenyl]-2-methylpropan-2-ol is CC(C)(O)Cc1ccc(-c2ccc(-c3nc(N)c(N)cc3Cl)cc2)cc1.
What is the InChIKey of 1-[4-[4-(5,6-diamino-3-chloro-2-pyridinyl)phenyl]phenyl]-2-methylpropan-2-ol?
The InChIKey is CUUZGLRZIOVDQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22ClN3O/c1-21(2,26)12-13-3-5-14(6-4-13)15-7-9-16(10-8-15)19-17(22)11-18(23)20(24)25-19/h3-11,26H,12,23H2,1-2H3,(H2,24,25).
What are the key properties of 1-[4-[4-(5,6-diamino-3-chloro-2-pyridinyl)phenyl]phenyl]-2-methylpropan-2-ol?
1-[4-[4-(5,6-diamino-3-chloro-2-pyridinyl)phenyl]phenyl]-2-methylpropan-2-ol has a molecular weight of 367.88 g/mol, XLogP of 4.55, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[4-(5,6-diamino-3-chloro-2-pyridinyl)phenyl]phenyl]-2-methylpropan-2-ol is sourced from PubChem (CID 138509029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).