C26H34F2O7S2 — CID 138509367
1,1-difluoro-2-[[4-[2-[2-(4-methyl-1,4-oxathian-4-yl)acetyl]phenyl]-1-adamantyl]methoxy]-2-oxoethanesulfonic acid (PubChem CID 138509367) has the molecular formula C26H34F2O7S2 and a molecular weight of 560.68 g/mol. Its IUPAC name is 1,1-difluoro-2-[[4-[2-[2-(4-methyl-1,4-oxathian-4-yl)acetyl]phenyl]-1-adamantyl]methoxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[[4-[2-[2-(4-methyl-1,4-oxathian-4-yl)acetyl]phenyl]-1-adamantyl]methoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 138509367 |
| Molecular Formula | C26H34F2O7S2 |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | 1,1-difluoro-2-[[4-[2-[2-(4-methyl-1,4-oxathian-4-yl)acetyl]phenyl]-1-adamantyl]methoxy]-2-oxoethanesulfonic acid |
| SMILES | CS1(CC(=O)c2ccccc2C2C3CC4CC2CC(COC(=O)C(F)(F)S(=O)(=O)O)(C4)C3)CCOCC1 |
| InChI | InChI=1S/C26H34F2O7S2/c1-36(8-6-34-7-9-36)15-22(29)20-4-2-3-5-21(20)23-18-10-17-11-19(23)14-25(12-17,13-18)16-35-24(30)26(27,28)37(31,32)33/h2-5,17-19,23H,6-16H2,1H3,(H,31,32,33) |
| InChIKey | GSPZJFGABIOXIU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|