About N-[(E)-5-amino-3-methylpent-4-enylidene]-N'-methylethanimidamide
N-[(E)-5-amino-3-methylpent-4-enylidene]-N'-methylethanimidamide (PubChem CID 138509392) has the molecular formula C9H17N3
and a molecular weight of 167.26 g/mol. Its IUPAC name is N-[(E)-5-amino-3-methylpent-4-enylidene]-N'-methylethanimidamide.
Molecular Properties
| Compound Name | N-[(E)-5-amino-3-methylpent-4-enylidene]-N'-methylethanimidamide |
| PubChem CID | 138509392 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | N-[(E)-5-amino-3-methylpent-4-enylidene]-N'-methylethanimidamide |
| SMILES | C/N=C(C)/N=C/CC(C)/C=C/N |
| InChI | InChI=1S/C9H17N3/c1-8(4-6-10)5-7-12-9(2)11-3/h4,6-8H,5,10H2,1-3H3/b6-4+,11-9+,12-7+ |
| InChIKey | YPJJHPZYTSFEMA-UJCGJXGCSA-N |
| XLogP | 1.60 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-5-amino-3-methylpent-4-enylidene]-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-5-amino-3-methylpent-4-enylidene]-N'-methylethanimidamide?
The IUPAC name of N-[(E)-5-amino-3-methylpent-4-enylidene]-N'-methylethanimidamide (CID 138509392) is N-[(E)-5-amino-3-methylpent-4-enylidene]-N'-methylethanimidamide.
What is the SMILES notation for N-[(E)-5-amino-3-methylpent-4-enylidene]-N'-methylethanimidamide?
The canonical SMILES for N-[(E)-5-amino-3-methylpent-4-enylidene]-N'-methylethanimidamide is C/N=C(C)/N=C/CC(C)/C=C/N.
What is the InChIKey of N-[(E)-5-amino-3-methylpent-4-enylidene]-N'-methylethanimidamide?
The InChIKey is YPJJHPZYTSFEMA-UJCGJXGCSA-N. The full InChI is InChI=1S/C9H17N3/c1-8(4-6-10)5-7-12-9(2)11-3/h4,6-8H,5,10H2,1-3H3/b6-4+,11-9+,12-7+.
What are the key properties of N-[(E)-5-amino-3-methylpent-4-enylidene]-N'-methylethanimidamide?
N-[(E)-5-amino-3-methylpent-4-enylidene]-N'-methylethanimidamide has a molecular weight of 167.26 g/mol, XLogP of 1.60, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-5-amino-3-methylpent-4-enylidene]-N'-methylethanimidamide is sourced from PubChem (CID 138509392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).