C11H17F3O — CID 138509505
(2E,4Z)-7,7,7-trifluoro-2-methoxy-4,6,6-trimethylhepta-2,4-diene (PubChem CID 138509505) has the molecular formula C11H17F3O and a molecular weight of 222.25 g/mol. Its IUPAC name is (2E,4Z)-7,7,7-trifluoro-2-methoxy-4,6,6-trimethylhepta-2,4-diene.
| Compound Name | (2E,4Z)-7,7,7-trifluoro-2-methoxy-4,6,6-trimethylhepta-2,4-diene |
|---|---|
| PubChem CID | 138509505 |
| Molecular Formula | C11H17F3O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | (2E,4Z)-7,7,7-trifluoro-2-methoxy-4,6,6-trimethylhepta-2,4-diene |
| SMILES | CO/C(C)=C/C(C)=C\C(C)(C)C(F)(F)F |
| InChI | InChI=1S/C11H17F3O/c1-8(6-9(2)15-5)7-10(3,4)11(12,13)14/h6-7H,1-5H3/b8-7-,9-6+ |
| InChIKey | DGBJBRLJIIKFGN-SOKJVCRVSA-N |
| XLogP | 4.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|