C34H48F2O8S — CID 138509551
2-[4-[3-(2,3-dihydro-1-benzofuran-5-carbonyl)-2,2-dimethyl-7-propoxyheptyl]adamantane-1-carbonyl]oxy-1,1-difluoroethanesulfonic acid (PubChem CID 138509551) has the molecular formula C34H48F2O8S and a molecular weight of 654.81 g/mol. Its IUPAC name is 2-[4-[3-(2,3-dihydro-1-benzofuran-5-carbonyl)-2,2-dimethyl-7-propoxyheptyl]adamantane-1-carbonyl]oxy-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-[4-[3-(2,3-dihydro-1-benzofuran-5-carbonyl)-2,2-dimethyl-7-propoxyheptyl]adamantane-1-carbonyl]oxy-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 138509551 |
| Molecular Formula | C34H48F2O8S |
| Molecular Weight | 654.81 g/mol |
| Exact Mass | 654.30 |
| IUPAC Name | 2-[4-[3-(2,3-dihydro-1-benzofuran-5-carbonyl)-2,2-dimethyl-7-propoxyheptyl]adamantane-1-carbonyl]oxy-1,1-difluoroethanesulfonic acid |
| SMILES | CCCOCCCCC(C(=O)c1ccc2c(c1)CCO2)C(C)(C)CC1C2CC3CC1CC(C(=O)OCC(F)(F)S(=O)(=O)O)(C3)C2 |
| InChI | InChI=1S/C34H48F2O8S/c1-4-11-42-12-6-5-7-28(30(37)24-8-9-29-23(16-24)10-13-43-29)32(2,3)20-27-25-14-22-15-26(27)19-33(17-22,18-25)31(38)44-21-34(35,36)45(39,40)41/h8-9,16,22,25-28H,4-7,10-15,17-21H2,1-3H3,(H,39,40,41) |
| InChIKey | VFEJUFPDRJHROU-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.81 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|