C16H28N2O2S — CID 138509657
(3aS,5S)-N-heptan-4-yl-2-methylsulfanyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-5-carboxamide (PubChem CID 138509657) has the molecular formula C16H28N2O2S and a molecular weight of 312.48 g/mol. Its IUPAC name is (3aS,5S)-N-heptan-4-yl-2-methylsulfanyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-5-carboxamide.
| Compound Name | (3aS,5S)-N-heptan-4-yl-2-methylsulfanyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 138509657 |
| Molecular Formula | C16H28N2O2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | (3aS,5S)-N-heptan-4-yl-2-methylsulfanyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-5-carboxamide |
| SMILES | CCCC(CCC)NC(=O)[C@H]1CCC2OC(SC)=N[C@H]2C1 |
| InChI | InChI=1S/C16H28N2O2S/c1-4-6-12(7-5-2)17-15(19)11-8-9-14-13(10-11)18-16(20-14)21-3/h11-14H,4-10H2,1-3H3,(H,17,19)/t11-,13-,14?/m0/s1 |
| InChIKey | RCMWQHMLAKGQDU-ULVQEXTCSA-N |
| XLogP | 3.36 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |