C42H31N3O2 — CID 138509772
2-[3-(7,7-dimethyl-4a,13a-dihydroxantheno[5,6-b][1]benzofuran-9-yl)phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 138509772) has the molecular formula C42H31N3O2 and a molecular weight of 609.73 g/mol. Its IUPAC name is 2-[3-(7,7-dimethyl-4a,13a-dihydroxantheno[5,6-b][1]benzofuran-9-yl)phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-(7,7-dimethyl-4a,13a-dihydroxantheno[5,6-b][1]benzofuran-9-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 138509772 |
| Molecular Formula | C42H31N3O2 |
| Molecular Weight | 609.73 g/mol |
| Exact Mass | 609.24 |
| IUPAC Name | 2-[3-(7,7-dimethyl-4a,13a-dihydroxantheno[5,6-b][1]benzofuran-9-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC1(C)c2cc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)ccc2Oc2c1ccc1c2OC2C=CC=CC12 |
| InChI | InChI=1S/C42H31N3O2/c1-42(2)33-22-21-32-31-18-9-10-19-35(31)46-37(32)38(33)47-36-23-20-29(25-34(36)42)28-16-11-17-30(24-28)41-44-39(26-12-5-3-6-13-26)43-40(45-41)27-14-7-4-8-15-27/h3-25,31,35H,1-2H3 |
| InChIKey | FIKBSBXBJBMGCL-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.73 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |