C20H28N2O3 — CID 138509944
5-cyclohexyl-3,5-dimethyl-1-[(3E,5Z)-2-oxoocta-3,5,7-trienyl]-1,3-diazinane-2,4-dione (PubChem CID 138509944) has the molecular formula C20H28N2O3 and a molecular weight of 344.45 g/mol. Its IUPAC name is 5-cyclohexyl-3,5-dimethyl-1-[(3E,5Z)-2-oxoocta-3,5,7-trienyl]-1,3-diazinane-2,4-dione.
| Compound Name | 5-cyclohexyl-3,5-dimethyl-1-[(3E,5Z)-2-oxoocta-3,5,7-trienyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 138509944 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 5-cyclohexyl-3,5-dimethyl-1-[(3E,5Z)-2-oxoocta-3,5,7-trienyl]-1,3-diazinane-2,4-dione |
| SMILES | C=C/C=C\C=C\C(=O)CN1CC(C)(C2CCCCC2)C(=O)N(C)C1=O |
| InChI | InChI=1S/C20H28N2O3/c1-4-5-6-10-13-17(23)14-22-15-20(2,16-11-8-7-9-12-16)18(24)21(3)19(22)25/h4-6,10,13,16H,1,7-9,11-12,14-15H2,2-3H3/b6-5-,13-10+ |
| InChIKey | CHZIUKIUAUZKAC-UHYAQULISA-N |
| XLogP | 3.33 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|