C29H40F2N2O5 — CID 138509952
N-(2,2-difluoroethyl)-N-[1-[(6E)-2,3-dihydroxy-6-methoxyimino-10,13-dimethyl-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethyl]furan-2-carboxamide (PubChem CID 138509952) has the molecular formula C29H40F2N2O5 and a molecular weight of 534.64 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N-[1-[(6E)-2,3-dihydroxy-6-methoxyimino-10,13-dimethyl-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethyl]furan-2-carboxamide.
| Compound Name | N-(2,2-difluoroethyl)-N-[1-[(6E)-2,3-dihydroxy-6-methoxyimino-10,13-dimethyl-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 138509952 |
| Molecular Formula | C29H40F2N2O5 |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.29 |
| IUPAC Name | N-(2,2-difluoroethyl)-N-[1-[(6E)-2,3-dihydroxy-6-methoxyimino-10,13-dimethyl-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethyl]furan-2-carboxamide |
| SMILES | CO/N=C1\C=C2C(CCC3(C)C2CCC3C(C)N(CC(F)F)C(=O)c2ccco2)C2(C)CC(O)C(O)CC12 |
| InChI | InChI=1S/C29H40F2N2O5/c1-16(33(15-26(30)31)27(36)25-6-5-11-38-25)18-7-8-19-17-12-22(32-37-4)21-13-23(34)24(35)14-29(21,3)20(17)9-10-28(18,19)2/h5-6,11-12,16,18-21,23-24,26,34-35H,7-10,13-15H2,1-4H3/b32-22+ |
| InChIKey | YRVVKOKUGWYKFU-WEMUVCOSSA-N |
| XLogP | 4.90 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|