C20H23FN2O4 — CID 138509969
5-cyclohex-2-en-1-yl-1-[(3E)-3-ethenyl-5-fluoro-2-oxohexa-3,5-dienyl]-3,5-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 138509969) has the molecular formula C20H23FN2O4 and a molecular weight of 374.41 g/mol. Its IUPAC name is 5-cyclohex-2-en-1-yl-1-[(3E)-3-ethenyl-5-fluoro-2-oxohexa-3,5-dienyl]-3,5-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-cyclohex-2-en-1-yl-1-[(3E)-3-ethenyl-5-fluoro-2-oxohexa-3,5-dienyl]-3,5-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 138509969 |
| Molecular Formula | C20H23FN2O4 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 5-cyclohex-2-en-1-yl-1-[(3E)-3-ethenyl-5-fluoro-2-oxohexa-3,5-dienyl]-3,5-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | C=C/C(=C\C(=C)F)C(=O)CN1C(=O)N(C)C(=O)C(C)(C2C=CCCC2)C1=O |
| InChI | InChI=1S/C20H23FN2O4/c1-5-14(11-13(2)21)16(24)12-23-18(26)20(3,15-9-7-6-8-10-15)17(25)22(4)19(23)27/h5,7,9,11,15H,1-2,6,8,10,12H2,3-4H3/b14-11+ |
| InChIKey | QKQONPJRBNTZDT-SDNWHVSQSA-N |
| XLogP | 2.93 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|