C21H25FN2O4 — CID 138510089
5-(cyclohexen-1-yl)-1-ethyl-3-[(3E,5Z)-7-fluoro-2-oxoocta-3,5,7-trienyl]-5-methyl-1,3-diazinane-2,4,6-trione (PubChem CID 138510089) has the molecular formula C21H25FN2O4 and a molecular weight of 388.44 g/mol. Its IUPAC name is 5-(cyclohexen-1-yl)-1-ethyl-3-[(3E,5Z)-7-fluoro-2-oxoocta-3,5,7-trienyl]-5-methyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(cyclohexen-1-yl)-1-ethyl-3-[(3E,5Z)-7-fluoro-2-oxoocta-3,5,7-trienyl]-5-methyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 138510089 |
| Molecular Formula | C21H25FN2O4 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 5-(cyclohexen-1-yl)-1-ethyl-3-[(3E,5Z)-7-fluoro-2-oxoocta-3,5,7-trienyl]-5-methyl-1,3-diazinane-2,4,6-trione |
| SMILES | C=C(F)/C=C\C=C\C(=O)CN1C(=O)N(CC)C(=O)C(C)(C2=CCCCC2)C1=O |
| InChI | InChI=1S/C21H25FN2O4/c1-4-23-18(26)21(3,16-11-6-5-7-12-16)19(27)24(20(23)28)14-17(25)13-9-8-10-15(2)22/h8-11,13H,2,4-7,12,14H2,1,3H3/b10-8-,13-9+ |
| InChIKey | QZDIPROPXVVURB-KKCPJAHZSA-N |
| XLogP | 3.47 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|