C18H24N2O3 — CID 138510101
5-cyclopentyl-1,5-dimethyl-3-[(4Z)-3-methylidene-2-oxohepta-4,6-dienyl]imidazolidine-2,4-dione (PubChem CID 138510101) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 5-cyclopentyl-1,5-dimethyl-3-[(4Z)-3-methylidene-2-oxohepta-4,6-dienyl]imidazolidine-2,4-dione.
| Compound Name | 5-cyclopentyl-1,5-dimethyl-3-[(4Z)-3-methylidene-2-oxohepta-4,6-dienyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 138510101 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 5-cyclopentyl-1,5-dimethyl-3-[(4Z)-3-methylidene-2-oxohepta-4,6-dienyl]imidazolidine-2,4-dione |
| SMILES | C=C/C=C\C(=C)C(=O)CN1C(=O)N(C)C(C)(C2CCCC2)C1=O |
| InChI | InChI=1S/C18H24N2O3/c1-5-6-9-13(2)15(21)12-20-16(22)18(3,19(4)17(20)23)14-10-7-8-11-14/h5-6,9,14H,1-2,7-8,10-12H2,3-4H3/b9-6- |
| InChIKey | MEZBNAWRNSVTIQ-TWGQIWQCSA-N |
| XLogP | 2.70 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|