C22H29N3O3 — CID 138510102
3-[(4Z)-7-amino-3-methylidene-2-oxoocta-4,7-dienyl]-5-[(3Z)-3-ethenylhexa-3,5-dienyl]-1,5-dimethylimidazolidine-2,4-dione (PubChem CID 138510102) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 3-[(4Z)-7-amino-3-methylidene-2-oxoocta-4,7-dienyl]-5-[(3Z)-3-ethenylhexa-3,5-dienyl]-1,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[(4Z)-7-amino-3-methylidene-2-oxoocta-4,7-dienyl]-5-[(3Z)-3-ethenylhexa-3,5-dienyl]-1,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 138510102 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 3-[(4Z)-7-amino-3-methylidene-2-oxoocta-4,7-dienyl]-5-[(3Z)-3-ethenylhexa-3,5-dienyl]-1,5-dimethylimidazolidine-2,4-dione |
| SMILES | C=C/C=C(\C=C)CCC1(C)C(=O)N(CC(=O)C(=C)/C=C\CC(=C)N)C(=O)N1C |
| InChI | InChI=1S/C22H29N3O3/c1-7-10-18(8-2)13-14-22(5)20(27)25(21(28)24(22)6)15-19(26)16(3)11-9-12-17(4)23/h7-11H,1-4,12-15,23H2,5-6H3/b11-9-,18-10+ |
| InChIKey | QASDQRDNIPLXEK-GWNMMOMOSA-N |
| XLogP | 3.26 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|