C20H28N2O3 — CID 138510123
1,5-dimethyl-5-(2-methylcyclohexyl)-3-[(4Z)-3-methylidene-2-oxohepta-4,6-dienyl]imidazolidine-2,4-dione (PubChem CID 138510123) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is 1,5-dimethyl-5-(2-methylcyclohexyl)-3-[(4Z)-3-methylidene-2-oxohepta-4,6-dienyl]imidazolidine-2,4-dione.
| Compound Name | 1,5-dimethyl-5-(2-methylcyclohexyl)-3-[(4Z)-3-methylidene-2-oxohepta-4,6-dienyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 138510123 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 1,5-dimethyl-5-(2-methylcyclohexyl)-3-[(4Z)-3-methylidene-2-oxohepta-4,6-dienyl]imidazolidine-2,4-dione |
| SMILES | C=C/C=C\C(=C)C(=O)CN1C(=O)N(C)C(C)(C2CCCCC2C)C1=O |
| InChI | InChI=1S/C20H28N2O3/c1-6-7-10-15(3)17(23)13-22-18(24)20(4,21(5)19(22)25)16-12-9-8-11-14(16)2/h6-7,10,14,16H,1,3,8-9,11-13H2,2,4-5H3/b10-7- |
| InChIKey | YMFWUPHAGCLOQJ-YFHOEESVSA-N |
| XLogP | 3.33 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|