C21H25N3O3 — CID 138510126
5-(6-azabicyclo[3.2.2]nona-1(8),5(9)-dien-7-yl)-1,5-dimethyl-3-[(4Z)-3-methylidene-2-oxohepta-4,6-dienyl]imidazolidine-2,4-dione (PubChem CID 138510126) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 5-(6-azabicyclo[3.2.2]nona-1(8),5(9)-dien-7-yl)-1,5-dimethyl-3-[(4Z)-3-methylidene-2-oxohepta-4,6-dienyl]imidazolidine-2,4-dione.
| Compound Name | 5-(6-azabicyclo[3.2.2]nona-1(8),5(9)-dien-7-yl)-1,5-dimethyl-3-[(4Z)-3-methylidene-2-oxohepta-4,6-dienyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 138510126 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 5-(6-azabicyclo[3.2.2]nona-1(8),5(9)-dien-7-yl)-1,5-dimethyl-3-[(4Z)-3-methylidene-2-oxohepta-4,6-dienyl]imidazolidine-2,4-dione |
| SMILES | C=C/C=C\C(=C)C(=O)CN1C(=O)N(C)C(C)(C2NC3=CC=C2CCC3)C1=O |
| InChI | InChI=1S/C21H25N3O3/c1-5-6-8-14(2)17(25)13-24-19(26)21(3,23(4)20(24)27)18-15-9-7-10-16(22-18)12-11-15/h5-6,8,11-12,18,22H,1-2,7,9-10,13H2,3-4H3/b8-6- |
| InChIKey | NAIDBSSXTPEXHX-VURMDHGXSA-N |
| XLogP | 2.47 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|