C19H24N2O3 — CID 138510136
5-cyclohex-2-en-1-yl-3-[(3E)-3-ethenyl-2-oxohexa-3,5-dienyl]-1,5-dimethylimidazolidine-2,4-dione (PubChem CID 138510136) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 5-cyclohex-2-en-1-yl-3-[(3E)-3-ethenyl-2-oxohexa-3,5-dienyl]-1,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 5-cyclohex-2-en-1-yl-3-[(3E)-3-ethenyl-2-oxohexa-3,5-dienyl]-1,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 138510136 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 5-cyclohex-2-en-1-yl-3-[(3E)-3-ethenyl-2-oxohexa-3,5-dienyl]-1,5-dimethylimidazolidine-2,4-dione |
| SMILES | C=C/C=C(\C=C)C(=O)CN1C(=O)N(C)C(C)(C2C=CCCC2)C1=O |
| InChI | InChI=1S/C19H24N2O3/c1-5-10-14(6-2)16(22)13-21-17(23)19(3,20(4)18(21)24)15-11-8-7-9-12-15/h5-6,8,10-11,15H,1-2,7,9,12-13H2,3-4H3/b14-10+ |
| InChIKey | HJQCKSMGYFPKEK-GXDHUFHOSA-N |
| XLogP | 2.86 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|