C22H28N2O3 — CID 138510163
5-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-1,5-dimethyl-3-[(3E,5Z)-2-oxoocta-3,5,7-trienyl]imidazolidine-2,4-dione (PubChem CID 138510163) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 5-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-1,5-dimethyl-3-[(3E,5Z)-2-oxoocta-3,5,7-trienyl]imidazolidine-2,4-dione.
| Compound Name | 5-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-1,5-dimethyl-3-[(3E,5Z)-2-oxoocta-3,5,7-trienyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 138510163 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 5-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-1,5-dimethyl-3-[(3E,5Z)-2-oxoocta-3,5,7-trienyl]imidazolidine-2,4-dione |
| SMILES | C=C/C=C\C=C\C(=O)CN1C(=O)N(C)C(C)(C2=CC[C@H]3C[C@@H]2C3(C)C)C1=O |
| InChI | InChI=1S/C22H28N2O3/c1-6-7-8-9-10-16(25)14-24-19(26)22(4,23(5)20(24)27)17-12-11-15-13-18(17)21(15,2)3/h6-10,12,15,18H,1,11,13-14H2,2-5H3/b8-7-,10-9+/t15-,18-,22?/m0/s1 |
| InChIKey | HBMPLNNBKZQWRI-AVZZZCSJSA-N |
| XLogP | 3.50 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|