C19H23FN2O4 — CID 138510243
5-cyclopentyl-1-[(3E,5Z)-7-fluoro-2-oxoocta-3,5,7-trienyl]-3,5-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 138510243) has the molecular formula C19H23FN2O4 and a molecular weight of 362.40 g/mol. Its IUPAC name is 5-cyclopentyl-1-[(3E,5Z)-7-fluoro-2-oxoocta-3,5,7-trienyl]-3,5-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-cyclopentyl-1-[(3E,5Z)-7-fluoro-2-oxoocta-3,5,7-trienyl]-3,5-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 138510243 |
| Molecular Formula | C19H23FN2O4 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 5-cyclopentyl-1-[(3E,5Z)-7-fluoro-2-oxoocta-3,5,7-trienyl]-3,5-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | C=C(F)/C=C\C=C\C(=O)CN1C(=O)N(C)C(=O)C(C)(C2CCCC2)C1=O |
| InChI | InChI=1S/C19H23FN2O4/c1-13(20)8-4-7-11-15(23)12-22-17(25)19(2,14-9-5-6-10-14)16(24)21(3)18(22)26/h4,7-8,11,14H,1,5-6,9-10,12H2,2-3H3/b8-4-,11-7+ |
| InChIKey | BPAQJLDEVWRJTG-USRDNGHPSA-N |
| XLogP | 2.77 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|