C18H34N2S — CID 138510618
(3E,5Z)-N-(2-ethylsulfanylethyl)-2-methyl-4-(pyrrolidin-1-ylmethyl)octa-3,5-dien-1-amine (PubChem CID 138510618) has the molecular formula C18H34N2S and a molecular weight of 310.55 g/mol. Its IUPAC name is (3E,5Z)-N-(2-ethylsulfanylethyl)-2-methyl-4-(pyrrolidin-1-ylmethyl)octa-3,5-dien-1-amine.
| Compound Name | (3E,5Z)-N-(2-ethylsulfanylethyl)-2-methyl-4-(pyrrolidin-1-ylmethyl)octa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 138510618 |
| Molecular Formula | C18H34N2S |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | (3E,5Z)-N-(2-ethylsulfanylethyl)-2-methyl-4-(pyrrolidin-1-ylmethyl)octa-3,5-dien-1-amine |
| SMILES | CC/C=C\C(=C/C(C)CNCCSCC)CN1CCCC1 |
| InChI | InChI=1S/C18H34N2S/c1-4-6-9-18(16-20-11-7-8-12-20)14-17(3)15-19-10-13-21-5-2/h6,9,14,17,19H,4-5,7-8,10-13,15-16H2,1-3H3/b9-6-,18-14+ |
| InChIKey | CZEDSEFJXQYHAO-BFKYHDNESA-N |
| XLogP | 3.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|