C20H19F2N — CID 138510814
(3E,7E,11Z)-3,7-difluoro-13-methyl-2,5,6,9,10-pentamethylidenetetradeca-3,7,11,13-tetraenenitrile (PubChem CID 138510814) has the molecular formula C20H19F2N and a molecular weight of 311.38 g/mol. Its IUPAC name is (3E,7E,11Z)-3,7-difluoro-13-methyl-2,5,6,9,10-pentamethylidenetetradeca-3,7,11,13-tetraenenitrile.
| Compound Name | (3E,7E,11Z)-3,7-difluoro-13-methyl-2,5,6,9,10-pentamethylidenetetradeca-3,7,11,13-tetraenenitrile |
|---|---|
| PubChem CID | 138510814 |
| Molecular Formula | C20H19F2N |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | (3E,7E,11Z)-3,7-difluoro-13-methyl-2,5,6,9,10-pentamethylidenetetradeca-3,7,11,13-tetraenenitrile |
| SMILES | C=C(C)/C=C\C(=C)C(=C)/C=C(/F)C(=C)C(=C)/C=C(/F)C(=C)C#N |
| InChI | InChI=1S/C20H19F2N/c1-13(2)8-9-14(3)15(4)10-20(22)18(7)16(5)11-19(21)17(6)12-23/h8-11H,1,3-7H2,2H3/b9-8-,19-11+,20-10+ |
| InChIKey | UYHLPFHLUFXSKU-YVINZCOASA-N |
| XLogP | 6.13 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|