C6H5Cl2NO — CID 138510819
2,3-dichloro-5-methyl-1H-pyridin-4-one (PubChem CID 138510819) has the molecular formula C6H5Cl2NO and a molecular weight of 178.02 g/mol. Its IUPAC name is 2,3-dichloro-5-methyl-1H-pyridin-4-one.
| Compound Name | 2,3-dichloro-5-methyl-1H-pyridin-4-one |
|---|---|
| PubChem CID | 138510819 |
| Molecular Formula | C6H5Cl2NO |
| Molecular Weight | 178.02 g/mol |
| Exact Mass | 176.97 |
| IUPAC Name | 2,3-dichloro-5-methyl-1H-pyridin-4-one |
| SMILES | Cc1c[nH]c(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C6H5Cl2NO/c1-3-2-9-6(8)4(7)5(3)10/h2H,1H3,(H,9,10) |
| InChIKey | VWPBFPPEAKDLRB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.02 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|