C25H32F3NO4 — CID 138510998
(2S,3R,4R)-2-(hydroxymethyl)-1-[5-[[4-phenyl-2-(trifluoromethyl)phenyl]methoxy]pentyl]piperidine-3,4-diol (PubChem CID 138510998) has the molecular formula C25H32F3NO4 and a molecular weight of 467.53 g/mol. Its IUPAC name is (2S,3R,4R)-2-(hydroxymethyl)-1-[5-[[4-phenyl-2-(trifluoromethyl)phenyl]methoxy]pentyl]piperidine-3,4-diol.
| Compound Name | (2S,3R,4R)-2-(hydroxymethyl)-1-[5-[[4-phenyl-2-(trifluoromethyl)phenyl]methoxy]pentyl]piperidine-3,4-diol |
|---|---|
| PubChem CID | 138510998 |
| Molecular Formula | C25H32F3NO4 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | (2S,3R,4R)-2-(hydroxymethyl)-1-[5-[[4-phenyl-2-(trifluoromethyl)phenyl]methoxy]pentyl]piperidine-3,4-diol |
| SMILES | OC[C@H]1[C@@H](O)[C@H](O)CCN1CCCCCOCc1ccc(-c2ccccc2)cc1C(F)(F)F |
| InChI | InChI=1S/C25H32F3NO4/c26-25(27,28)21-15-19(18-7-3-1-4-8-18)9-10-20(21)17-33-14-6-2-5-12-29-13-11-23(31)24(32)22(29)16-30/h1,3-4,7-10,15,22-24,30-32H,2,5-6,11-14,16-17H2/t22-,23+,24+/m0/s1 |
| InChIKey | MAQPFFPVSQDYLU-RBZQAINGSA-N |
| XLogP | 3.85 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|