C15H18F3N — CID 138511239
(2E,5Z,7Z)-7,8-difluoro-3-[(1Z)-3-fluoro-2-methylbuta-1,3-dienyl]deca-2,5,7,9-tetraen-2-amine (PubChem CID 138511239) has the molecular formula C15H18F3N and a molecular weight of 269.31 g/mol. Its IUPAC name is (2E,5Z,7Z)-7,8-difluoro-3-[(1Z)-3-fluoro-2-methylbuta-1,3-dienyl]deca-2,5,7,9-tetraen-2-amine.
| Compound Name | (2E,5Z,7Z)-7,8-difluoro-3-[(1Z)-3-fluoro-2-methylbuta-1,3-dienyl]deca-2,5,7,9-tetraen-2-amine |
|---|---|
| PubChem CID | 138511239 |
| Molecular Formula | C15H18F3N |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (2E,5Z,7Z)-7,8-difluoro-3-[(1Z)-3-fluoro-2-methylbuta-1,3-dienyl]deca-2,5,7,9-tetraen-2-amine |
| SMILES | C=C/C(F)=C(F)\C=C/CC(/C=C(/C)C(=C)F)=C(/C)N |
| InChI | InChI=1S/C15H18F3N/c1-5-14(17)15(18)8-6-7-13(12(4)19)9-10(2)11(3)16/h5-6,8-9H,1,3,7,19H2,2,4H3/b8-6-,10-9-,13-12+,15-14- |
| InChIKey | UERPBBOXZGHJAK-YQTJOAGNSA-N |
| XLogP | 4.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|