C17H20F4S — CID 138511414
(3Z,5Z,7Z,9Z)-2,9,10-trifluoro-5-(fluoromethylidene)-3,8-dimethyl-7-[(E)-2-methylsulfanylethenyl]undeca-1,3,7,9-tetraene (PubChem CID 138511414) has the molecular formula C17H20F4S and a molecular weight of 332.41 g/mol. Its IUPAC name is (3Z,5Z,7Z,9Z)-2,9,10-trifluoro-5-(fluoromethylidene)-3,8-dimethyl-7-[(E)-2-methylsulfanylethenyl]undeca-1,3,7,9-tetraene.
| Compound Name | (3Z,5Z,7Z,9Z)-2,9,10-trifluoro-5-(fluoromethylidene)-3,8-dimethyl-7-[(E)-2-methylsulfanylethenyl]undeca-1,3,7,9-tetraene |
|---|---|
| PubChem CID | 138511414 |
| Molecular Formula | C17H20F4S |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | (3Z,5Z,7Z,9Z)-2,9,10-trifluoro-5-(fluoromethylidene)-3,8-dimethyl-7-[(E)-2-methylsulfanylethenyl]undeca-1,3,7,9-tetraene |
| SMILES | C=C(F)/C(C)=C\C(=C/F)CC(/C=C/SC)=C(C)/C(F)=C(\C)F |
| InChI | InChI=1S/C17H20F4S/c1-11(13(3)19)8-15(10-18)9-16(6-7-22-5)12(2)17(21)14(4)20/h6-8,10H,3,9H2,1-2,4-5H3/b7-6+,11-8-,15-10+,16-12+,17-14- |
| InChIKey | UTMMDERLIQCNAE-FTIMPOBHSA-N |
| XLogP | 7.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|