C25H41FN2O4 — CID 138511473
(2S,3R,5R,6E,10R,13R,14S,17S)-17-[1-(2-fluoropropylamino)ethyl]-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol (PubChem CID 138511473) has the molecular formula C25H41FN2O4 and a molecular weight of 452.61 g/mol. Its IUPAC name is (2S,3R,5R,6E,10R,13R,14S,17S)-17-[1-(2-fluoropropylamino)ethyl]-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol.
| Compound Name | (2S,3R,5R,6E,10R,13R,14S,17S)-17-[1-(2-fluoropropylamino)ethyl]-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol |
|---|---|
| PubChem CID | 138511473 |
| Molecular Formula | C25H41FN2O4 |
| Molecular Weight | 452.61 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | (2S,3R,5R,6E,10R,13R,14S,17S)-17-[1-(2-fluoropropylamino)ethyl]-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol |
| SMILES | CO/N=C1\C=C2C(CC[C@]3(C)[C@@H](C(C)NCC(C)F)CC[C@@]23O)[C@@]2(C)C[C@H](O)[C@H](O)C[C@@H]12 |
| InChI | InChI=1S/C25H41FN2O4/c1-14(26)13-27-15(2)16-7-9-25(31)18-10-20(28-32-5)19-11-21(29)22(30)12-23(19,3)17(18)6-8-24(16,25)4/h10,14-17,19,21-22,27,29-31H,6-9,11-13H2,1-5H3/b28-20+/t14?,15?,16-,17?,19+,21-,22+,23-,24-,25-/m1/s1 |
| InChIKey | ZIYGXNQLXJFMEZ-ZRQKLGAUSA-N |
| XLogP | 2.96 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.61 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|