C22H31BrO5 — CID 138511476
(2S,3R,5R,10R,13R,14S,17S)-17-(2-bromoacetyl)-2,3,14-trihydroxy-5,10,13-trimethyl-1,2,3,4,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-6-one (PubChem CID 138511476) has the molecular formula C22H31BrO5 and a molecular weight of 455.39 g/mol. Its IUPAC name is (2S,3R,5R,10R,13R,14S,17S)-17-(2-bromoacetyl)-2,3,14-trihydroxy-5,10,13-trimethyl-1,2,3,4,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-6-one.
| Compound Name | (2S,3R,5R,10R,13R,14S,17S)-17-(2-bromoacetyl)-2,3,14-trihydroxy-5,10,13-trimethyl-1,2,3,4,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 138511476 |
| Molecular Formula | C22H31BrO5 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | (2S,3R,5R,10R,13R,14S,17S)-17-(2-bromoacetyl)-2,3,14-trihydroxy-5,10,13-trimethyl-1,2,3,4,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-6-one |
| SMILES | C[C@@]12C[C@@H](O)[C@@H](O)C[C@]1(C)C1CC[C@]3(C)[C@@H](C(=O)CBr)CC[C@@]3(O)C1=CC2=O |
| InChI | InChI=1S/C22H31BrO5/c1-19-6-4-12-14(22(19,28)7-5-13(19)17(26)11-23)8-18(27)21(3)10-16(25)15(24)9-20(12,21)2/h8,12-13,15-16,24-25,28H,4-7,9-11H2,1-3H3/t12?,13-,15+,16-,19-,20-,21+,22-/m1/s1 |
| InChIKey | BVPPJWWUGISGOP-ZNNQKISXSA-N |
| XLogP | 2.55 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|