About (2Z)-2-(2-oxopropylidene)-1,3-thiazolidin-4-one
(2Z)-2-(2-oxopropylidene)-1,3-thiazolidin-4-one (PubChem CID 138511626) has the molecular formula C6H7NO2S
and a molecular weight of 157.19 g/mol. Its IUPAC name is (2Z)-2-(2-oxopropylidene)-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | (2Z)-2-(2-oxopropylidene)-1,3-thiazolidin-4-one |
| PubChem CID | 138511626 |
| Molecular Formula | C6H7NO2S |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.02 |
| IUPAC Name | (2Z)-2-(2-oxopropylidene)-1,3-thiazolidin-4-one |
| SMILES | CC(=O)/C=C1/NC(=O)CS1 |
| InChI | InChI=1S/C6H7NO2S/c1-4(8)2-6-7-5(9)3-10-6/h2H,3H2,1H3,(H,7,9)/b6-2- |
| InChIKey | OBXFMFQSWVMTHK-KXFIGUGUSA-N |
| XLogP | 0.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-(2-oxopropylidene)-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(2-oxopropylidene)-1,3-thiazolidin-4-one?
The IUPAC name of (2Z)-2-(2-oxopropylidene)-1,3-thiazolidin-4-one (CID 138511626) is (2Z)-2-(2-oxopropylidene)-1,3-thiazolidin-4-one.
What is the SMILES notation for (2Z)-2-(2-oxopropylidene)-1,3-thiazolidin-4-one?
The canonical SMILES for (2Z)-2-(2-oxopropylidene)-1,3-thiazolidin-4-one is CC(=O)/C=C1/NC(=O)CS1.
What is the InChIKey of (2Z)-2-(2-oxopropylidene)-1,3-thiazolidin-4-one?
The InChIKey is OBXFMFQSWVMTHK-KXFIGUGUSA-N. The full InChI is InChI=1S/C6H7NO2S/c1-4(8)2-6-7-5(9)3-10-6/h2H,3H2,1H3,(H,7,9)/b6-2-.
What are the key properties of (2Z)-2-(2-oxopropylidene)-1,3-thiazolidin-4-one?
(2Z)-2-(2-oxopropylidene)-1,3-thiazolidin-4-one has a molecular weight of 157.19 g/mol, XLogP of 0.28, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(2-oxopropylidene)-1,3-thiazolidin-4-one is sourced from PubChem (CID 138511626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).