C11H18O4 — CID 138511647
(2R,3S,3aS,6aR)-2-methyl-3-[(2-methylpropan-2-yl)oxy]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one (PubChem CID 138511647) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is (2R,3S,3aS,6aR)-2-methyl-3-[(2-methylpropan-2-yl)oxy]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one.
| Compound Name | (2R,3S,3aS,6aR)-2-methyl-3-[(2-methylpropan-2-yl)oxy]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
|---|---|
| PubChem CID | 138511647 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (2R,3S,3aS,6aR)-2-methyl-3-[(2-methylpropan-2-yl)oxy]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
| SMILES | C[C@H]1O[C@@H]2CC(=O)O[C@@H]2[C@H]1OC(C)(C)C |
| InChI | InChI=1S/C11H18O4/c1-6-9(15-11(2,3)4)10-7(13-6)5-8(12)14-10/h6-7,9-10H,5H2,1-4H3/t6-,7-,9+,10+/m1/s1 |
| InChIKey | GTIXQFMECCNHAK-XFFJFQIUSA-N |
| XLogP | 1.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |