About [(2E,4Z)-hepta-2,4-dien-3-yl]thiourea
[(2E,4Z)-hepta-2,4-dien-3-yl]thiourea (PubChem CID 138511684) has the molecular formula C8H14N2S
and a molecular weight of 170.28 g/mol. Its IUPAC name is [(2E,4Z)-hepta-2,4-dien-3-yl]thiourea.
Molecular Properties
| Compound Name | [(2E,4Z)-hepta-2,4-dien-3-yl]thiourea |
| PubChem CID | 138511684 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | [(2E,4Z)-hepta-2,4-dien-3-yl]thiourea |
| SMILES | C/C=C(\C=C/CC)NC(N)=S |
| InChI | InChI=1S/C8H14N2S/c1-3-5-6-7(4-2)10-8(9)11/h4-6H,3H2,1-2H3,(H3,9,10,11)/b6-5-,7-4+ |
| InChIKey | UOKPBGLOFOUWAF-IUQJDUBZSA-N |
| XLogP | 1.69 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(2E,4Z)-hepta-2,4-dien-3-yl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E,4Z)-hepta-2,4-dien-3-yl]thiourea?
The IUPAC name of [(2E,4Z)-hepta-2,4-dien-3-yl]thiourea (CID 138511684) is [(2E,4Z)-hepta-2,4-dien-3-yl]thiourea.
What is the SMILES notation for [(2E,4Z)-hepta-2,4-dien-3-yl]thiourea?
The canonical SMILES for [(2E,4Z)-hepta-2,4-dien-3-yl]thiourea is C/C=C(\C=C/CC)NC(N)=S.
What is the InChIKey of [(2E,4Z)-hepta-2,4-dien-3-yl]thiourea?
The InChIKey is UOKPBGLOFOUWAF-IUQJDUBZSA-N. The full InChI is InChI=1S/C8H14N2S/c1-3-5-6-7(4-2)10-8(9)11/h4-6H,3H2,1-2H3,(H3,9,10,11)/b6-5-,7-4+.
What are the key properties of [(2E,4Z)-hepta-2,4-dien-3-yl]thiourea?
[(2E,4Z)-hepta-2,4-dien-3-yl]thiourea has a molecular weight of 170.28 g/mol, XLogP of 1.69, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E,4Z)-hepta-2,4-dien-3-yl]thiourea is sourced from PubChem (CID 138511684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).